Linolenic acid

PubChem CID5280934
StructureFind Similar Structures
Chemical SafetyLaboratory Chemical Safety Summary (LCSS) Datasheet
Molecular FormulaC18H30O2
Synonymslinolenic acid alpha-Linolenic acid 463-40-1 linolenate (9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid More…

What is the systematic name of linoleic acid?

Linoleic acid is an organic compound with the formula COOH(CH2)7CH=CHCH2CH=CH(CH2)4CH3. Both alkene groups are cis….Linoleic acid.

Names
Preferred IUPAC name (9Z,12Z)-Octadeca-9,12-dienoic acid
Other names cis,cis-9,12-Octadecadienoic acid C18:2 (Lipid numbers)
Identifiers
CAS Number60-33-3

Is linoleic and linolenic acid the same?

Linoleic acid is an essential fatty acid and is an omega-6 fatty acid. This is in contrast to α-linolenic acid (“longer name”), which is an omega-3 fatty acid. Both are essential fatty acids and the body is unable to synthesize them.

What is the empirical formula for palmitic acid?

Palmitic acid, or hexadecanoic acid in IUPAC nomenclature, is the most common saturated fatty acid found in animals, plants and microorganisms. Its chemical formula is CH3(CH2)14COOH, and its C:D. (the total number of carbon atoms to the number of carbon-carbon double-bonds) is 16:0.

Where do you find linoleic acid?

Linoleic acid is the predominant n-6 polyunsaturated fatty acid (PUFA) in the Western diet and we can obtain it from vegetable oils such as sunflower, safflower, soybean, corn, and canola oils as well as nuts and seeds.

Is linoleic acid monounsaturated or polyunsaturated?

Since linoleic acid has more than one double bond (it has two), it is a polyunsaturated fatty acid.

Which of the following is linoleic acid?

Linoleic acid is a polyunsaturated omega-6 fatty acid. It is a colorless or white oil that is virtually insoluble in water but soluble in many organic solvents. It typically occurs in nature as a triglyceride (ester of glycerin) rather than as a free fatty acid.

Where does linolenic acid come from?

Alpha-linolenic acid is a type of omega-3 fatty acid found in plants. It is found in flaxseed oil, and in canola, soy, perilla, and walnut oils. Alpha-linolenic acid is similar to the omega-3 fatty acids that are in fish oil, called eicosapentaenoic acid (EPA) and docosahexaenoic acid (DHA).

Is linolenic acid polyunsaturated?

Alpha-linolenic acid (ALA) is a plant-derived ω-3 polyunsaturated fatty acid.

Is linoleic acid an amino acid?

Linoleic Acid is a polyunsaturated essential fatty acid found mostly in plant oils. It is used in the biosynthesis of prostaglandins and cell membranes. Linoleic acid is an octadecadienoic acid in which the two double bonds are at positions 9 and 12 and have Z (cis) stereochemistry.

What is linoleic acid and why do we need it?

Linolenic acid most commonly refers to alpha-linolenic acid (ALA), an omega-3 fatty acid found in many nuts, vegetables and oils. Linoleic acid, on the other hand, typically refers to a type of omega-6 fatty acid commonly found in nut, seed and refined vegetable oils.

Is linoleic acid bad for your kidneys?

Daily intake of conjugated linoleic acid (CLA) does not affect kidney and liver function, says a new study with humans that adds compelling support to the safety of the ingredient.

Why is linoleic acid an essential fatty acid?

Linoleic acid and other omega-6 fatty acids are essential for good health. Linoleic acid helps maintain the skin, nerve, immune and reproductive systems, as well as various other bodily functions. Linoleic acid acts as a precursor, converting into other long-chain polyunsaturated fatty acids, including arachidonic acid and DGLA.

What is the difference between linoleic and linolenic acid?

However, the key difference between linoleic acid and linolenic acid is that linoleic acid contains two double bonds with cis configuration while linolenic acid contains three double bonds with cis configuration. According to the configurations in these compounds, we can denote linoleic acid as 18:2 cis-9,12 and linolenic acid as 18:3 cis-9,12,15.