The (S,S)-(-)-hydrobenzoin/Ca complex may be used to catalyze the direct asymmetric aldol reaction of acetophenone and pivalaldehyde to form (R)-3-hydroxy-4,4-dimethyl-1-phenylpentan-1-one. C2 symmetric chiral diol with versatile applications as a chiral auxiliary, building block, and chiral ligand.
Is Meso Hydrobenzoin soluble in water?
Supplier Sponsors
| Assay: | 95.00 to 100.00 |
|---|---|
| Melting Point: | 138.00 °C. @ 760.00 mm Hg |
| logP (o/w): | 1.910 |
| Soluble in: | |
| water, 2500 mg/L @ 20 °C (exp) |
What is reduced in Benzil?
Purpose: To prepare the diol, hydrobenzoin alcohol, by reducing benzil using sodium borohydride. Theory: Reduction is the process of adding hydrogen atoms onto a molecule in order to reduce multiple bonds into single ones. In this lab, the reducing agent, sodium borohydride, is used to reduce benzil into hydrobenzoin.
Is Hydrobenzoin a diol?
General description. (R,R)-(+)-Hydrobenzoin is a chiral 1,2-diol useful as a chiral reagent, building block, ligand or auxiliary in asymmetric synthesis.
What is the molar mass of Hydrobenzoin?
Identification of Hydrobenzoin Chemical Compound
| Chemical Formula | C14H14O2 |
|---|---|
| Molecular Weight | 214.25976 g/mol |
| IUPAC Name | 1,2-diphenylethane-1,2-diol |
| SMILES String | OC(C(O)c1ccccc1)c2ccccc2 |
| InChI | InChI=1S/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H |
What is the melting point of Hydrobenzoin?
134°C to 136°C
Specifications
| Melting Point | 134°C to 136°C |
|---|---|
| Beilstein | 2050814 |
| Merck Index | 14,4777 |
| Quantity | 5g |
| Solubility Information | Soluble in hot alcohol or chloroform. |
What is Hydrobenzoin soluble in?
Specifications
| Melting Point | 134°C to 136°C |
|---|---|
| Solubility Information | Soluble in hot alcohol or chloroform. |
| Formula Weight | 214.27 |
| Percent Purity | 99% |
| Chemical Name or Material | meso-Hydrobenzoin |
What is the melting point of benzoin?
278.6°F (137°C)
Benzoin/Melting point
How many stereoisomers of Hydrobenzoin are there?
three stereoisomers
There are three stereoisomers of hydrobenzoin – one meso and two enantiomeric chiral isomers. In the acid-catalyzed acetal formation with acetone, the chiral isomers react faster than the meso isomer.
What is the Iupac name of Hydrobenzoin?
Hydrobenzoin
| PubChem CID | 95447 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C14H14O2 |
| Synonyms | Hydrobenzoin 1,2-Diphenylethane-1,2-diol (+/-)-Hydrobenzoin 492-70-6 655-48-1 More… |
| Molecular Weight | 214.26 |
What is the boiling point of benzoin?
651.2°F (344°C)
Benzoin/Boiling point
What is the melting point of meso Hydrobenzoin?
What is the percentage yield of hydrobenzoin from benzil reduction?
Stereochemical Analysis of Benzil Reduction. The melting point range of the hydrobenzoin product was found to be 136.1– 136.5 O C (Lit. 1 137 – 139 O C). The overall percent yield of this series of reactions was calculated to be 44.45%, while the percent yield for the formation of the hydrobenzoin was calculated to be 60.62%.
How do you determine the stereochemistry of hydrobenzoin?
In order to accurately determine the stereochemistry of the product or products formed, a derivative of the hydrobenzoin, with a distinct NMR must be made. In this case, the formation of an acetal of the hydrobenzoin product (Figure 4) will aid in determining the stereochemistry of the product.
What is the molecular weight of hydhydrobenzoin?
Hydrobenzoin PubChem CID 95447 Synonyms Hydrobenzoin 1,2-Diphenylethane-1,2-diol Molecular Weight 214.26 Date s Modify 2021-07-03 Create 2005-03-26
What is the stereochemical analysis of benzil reduction?
Stereochemical Analysis of Benzil Reduction. This series of reactions (Figure 1) were carried out first using benzil and sodium borohydride to form the hydrobenzoin product, then the hydrobenzoin product was combined with anhydrous acetone and iron trichloride to form the product (4S-5R)-2,2-dimethyl-4,5-diphenyl-1,3-dioxolane.